Type: Neutral
Formula: C16H18N2O2S
| SMILES: |
s1cc(cc1)C(N1CCCC1C(O)=O)Cc1ncccc1 |
| InChI: |
InChI=1/C16H18N2O2S/c19-16(20)14-5-3-8-18(14)15(12-6-9-21-11-12)10-13-4-1-2-7-17-13/h1-2,4,6-7,9,11,14-15H,3,5,8,10H2,(H,19,20)/t14-,15-/m1/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 302.398 g/mol | logS: -2.18245 | SlogP: 3.07137 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.198044 | Sterimol/B1: 2.73518 | Sterimol/B2: 3.20509 | Sterimol/B3: 4.61656 |
| Sterimol/B4: 7.09188 | Sterimol/L: 13.2669 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 489.917 | Positive charged surface: 304.014 | Negative charged surface: 185.904 | Volume: 280.75 |
| Hydrophobic surface: 432.641 | Hydrophilic surface: 57.276 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 2 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |