Type: Neutral
Formula: C17H18N6O4
SMILES: |
O1C(CO)C(n2nc(nn2)-c2ccccc2)CC1N1C=C(C)C(=O)NC1=O |
InChI: |
InChI=1/C17H18N6O4/c1-10-8-22(17(26)18-16(10)25)14-7-12(13(9-24)27-14)23-20-15(19-21-23)11-5-3-2-4-6-11/h2-6,8,12-14,24H,7,9H2,1H3,(H,18,25,26)/t12-,13+,14+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 370.369 g/mol | logS: -2.82004 | SlogP: 0.5396 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.050003 | Sterimol/B1: 3.35035 | Sterimol/B2: 4.11538 | Sterimol/B3: 5.47004 |
Sterimol/B4: 5.4777 | Sterimol/L: 18.8388 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 621.45 | Positive charged surface: 366.443 | Negative charged surface: 255.007 | Volume: 325.625 |
Hydrophobic surface: 400.946 | Hydrophilic surface: 220.504 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |