Type: Neutral
Formula: C17H22N2O5
SMILES: |
O(C)c1cc(ccc1O)C1NC(=O)NC(=C)C1C(OC(CC)C)=O |
InChI: |
InChI=1/C17H22N2O5/c1-5-9(2)24-16(21)14-10(3)18-17(22)19-15(14)11-6-7-12(20)13(8-11)23-4/h6-9,14-15,20H,3,5H2,1-2,4H3,(H2,18,19,22)/t9-,14-,15-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 334.372 g/mol | logS: -2.79212 | SlogP: 2.3218 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.355726 | Sterimol/B1: 3.40047 | Sterimol/B2: 4.14044 | Sterimol/B3: 5.68857 |
Sterimol/B4: 6.23457 | Sterimol/L: 12.8125 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 538.73 | Positive charged surface: 360.537 | Negative charged surface: 178.194 | Volume: 317 |
Hydrophobic surface: 321.104 | Hydrophilic surface: 217.626 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |