Type: Neutral
Formula: C13H24N2O4
SMILES: |
OC(CNC(=O)C(CC=C)CC(=O)NC(CO)C)C |
InChI: |
InChI=1/C13H24N2O4/c1-4-5-11(13(19)14-7-10(3)17)6-12(18)15-9(2)8-16/h4,9-11,16-17H,1,5-8H2,2-3H3,(H,14,19)(H,15,18)/t9-,10-,11+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 272.345 g/mol | logS: -0.82847 | SlogP: -0.4372 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0791893 | Sterimol/B1: 2.29717 | Sterimol/B2: 3.52454 | Sterimol/B3: 3.86855 |
Sterimol/B4: 8.23283 | Sterimol/L: 16.0416 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 567.643 | Positive charged surface: 407.476 | Negative charged surface: 160.167 | Volume: 276.375 |
Hydrophobic surface: 326.45 | Hydrophilic surface: 241.193 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |