Type: Neutral
Formula: C6H14NO8P
SMILES: |
P(OC1C(O)C(O)C(N)C(O)C1O)(O)(O)=O |
InChI: |
InChI=1/C6H14NO8P/c7-1-2(8)4(10)6(5(11)3(1)9)15-16(12,13)14/h1-6,8-11H,7H2,(H2,12,13,14)/t1-,2-,3-,4-,5-,6-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 259.151 g/mol | logS: 1.79438 | SlogP: -4.8214 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.133801 | Sterimol/B1: 3.1003 | Sterimol/B2: 3.46518 | Sterimol/B3: 4.10634 |
Sterimol/B4: 4.46006 | Sterimol/L: 12.2259 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 410.598 | Positive charged surface: 276.247 | Negative charged surface: 134.351 | Volume: 192.125 |
Hydrophobic surface: 69.0089 | Hydrophilic surface: 341.5891 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 8 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules
|