Type: Neutral
Formula: C14H13N5O3S
SMILES: |
s1ccnc1NC(=O)C(NC(=O)c1cc2[nH]cnc2cc1)CO |
InChI: |
InChI=1/C14H13N5O3S/c20-6-11(13(22)19-14-15-3-4-23-14)18-12(21)8-1-2-9-10(5-8)17-7-16-9/h1-5,7,11,20H,6H2,(H,16,17)(H,18,21)(H,15,19,22)/t11-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 331.356 g/mol | logS: -3.21597 | SlogP: 0.7488 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0405427 | Sterimol/B1: 3.38583 | Sterimol/B2: 3.5144 | Sterimol/B3: 3.55678 |
Sterimol/B4: 5.37056 | Sterimol/L: 18.8029 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 552.402 | Positive charged surface: 346.41 | Negative charged surface: 205.992 | Volume: 283.875 |
Hydrophobic surface: 355.037 | Hydrophilic surface: 197.365 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |