Type: Neutral
Formula: C19H22N2O5
SMILES: |
O(C)c1ccc(cc1)CCNC(CC(=O)Nc1cc(O)ccc1)C(O)=O |
InChI: |
InChI=1/C19H22N2O5/c1-26-16-7-5-13(6-8-16)9-10-20-17(19(24)25)12-18(23)21-14-3-2-4-15(22)11-14/h2-8,11,17,20,22H,9-10,12H2,1H3,(H,21,23)(H,24,25)/t17-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 358.394 g/mol | logS: -2.74947 | SlogP: 2.01487 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0588257 | Sterimol/B1: 2.95552 | Sterimol/B2: 3.00273 | Sterimol/B3: 4.25785 |
Sterimol/B4: 9.51095 | Sterimol/L: 17.7057 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 654.475 | Positive charged surface: 431.161 | Negative charged surface: 223.313 | Volume: 340.875 |
Hydrophobic surface: 464.074 | Hydrophilic surface: 190.401 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |