 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | s1cccc1C1NC(C2C1C(=O)N(Cc1ccccc1)C2=O)(C(CC)C)C(=O)[O-] |
| InChI: | InChI=1/C22H24N2O4S/c1-3-13(2)22(21(27)28)17-16(18(23-22)15-10-7-11-29-15)19(25)24(20(17)26)12-14-8-5-4-6-9-14/h4-11,13,16-18,23H,3,12H2,1-2H3,(H,27,28)/p-1/t13-,16+,17-,18+,22+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=79.4437 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 411.502 g/mol | logS: -4.46674 | SlogP: 2.0905 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.175234 | Sterimol/B1: 2.91067 | Sterimol/B2: 3.27813 | Sterimol/B3: 5.53887 | |||
| Sterimol/B4: 8.9197 | Sterimol/L: 14.4767 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 622.794 | Positive charged surface: 351.008 | Negative charged surface: 271.787 | Volume: 385.125 | |||
| Hydrophobic surface: 476.325 | Hydrophilic surface: 146.469 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 5 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
