Type: Neutral
Formula: C17H24N2O3
SMILES: |
OC(=O)C(NCC=C)CC(=O)Nc1ccc(cc1)CCCC |
InChI: |
InChI=1/C17H24N2O3/c1-3-5-6-13-7-9-14(10-8-13)19-16(20)12-15(17(21)22)18-11-4-2/h4,7-10,15,18H,2-3,5-6,11-12H2,1H3,(H,19,20)(H,21,22)/t15-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 304.39 g/mol | logS: -3.74748 | SlogP: 2.58657 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0471832 | Sterimol/B1: 2.4834 | Sterimol/B2: 4.5718 | Sterimol/B3: 5.07625 |
Sterimol/B4: 5.61114 | Sterimol/L: 18.8246 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 618.144 | Positive charged surface: 409.881 | Negative charged surface: 208.263 | Volume: 310.75 |
Hydrophobic surface: 408.799 | Hydrophilic surface: 209.345 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |