Type: Neutral
Formula: C4H8N2O6P2S
SMILES: |
s1ccnc1NC(P(O)(O)=O)P(O)(O)=O |
InChI: |
InChI=1/C4H8N2O6P2S/c7-13(8,9)4(14(10,11)12)6-3-5-1-2-15-3/h1-2,4H,(H,5,6)(H2,7,8,9)(H2,10,11,12) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 274.13 g/mol | logS: 1.24984 | SlogP: -1.9464 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.111486 | Sterimol/B1: 2.24254 | Sterimol/B2: 4.06248 | Sterimol/B3: 4.32537 |
Sterimol/B4: 4.36669 | Sterimol/L: 12.3299 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 402.107 | Positive charged surface: 188.683 | Negative charged surface: 213.424 | Volume: 186 |
Hydrophobic surface: 152.132 | Hydrophilic surface: 249.975 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |