Type: Neutral
Formula: C7H12N2O6P2
SMILES: |
P(O)(O)(=O)C(P(O)(O)=O)CNc1ncccc1 |
InChI: |
InChI=1/C7H12N2O6P2/c10-16(11,12)7(17(13,14)15)5-9-6-3-1-2-4-8-6/h1-4,7H,5H2,(H,8,9)(H2,10,11,12)(H2,13,14,15) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 282.129 g/mol | logS: 1.22385 | SlogP: -1.9654 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.167908 | Sterimol/B1: 2.44531 | Sterimol/B2: 4.2557 | Sterimol/B3: 4.83107 |
Sterimol/B4: 4.89933 | Sterimol/L: 12.7828 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 439.344 | Positive charged surface: 247.363 | Negative charged surface: 191.982 | Volume: 215 |
Hydrophobic surface: 187.135 | Hydrophilic surface: 252.209 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |