Type: Neutral
Formula: C20H19IN2
SMILES: |
Ic1cc(ccc1)CNc1c2CCCCc2nc2c1cccc2 |
InChI: |
InChI=1/C20H19IN2/c21-15-7-5-6-14(12-15)13-22-20-16-8-1-3-10-18(16)23-19-11-4-2-9-17(19)20/h1,3,5-8,10,12H,2,4,9,11,13H2,(H,22,23) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 414.29 g/mol | logS: -5.61811 | SlogP: 5.59664 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0356638 | Sterimol/B1: 2.73944 | Sterimol/B2: 2.79615 | Sterimol/B3: 2.9843 |
Sterimol/B4: 9.97718 | Sterimol/L: 14.4797 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 583.686 | Positive charged surface: 307.67 | Negative charged surface: 271.337 | Volume: 333 |
Hydrophobic surface: 547.776 | Hydrophilic surface: 35.91 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |