Type: Neutral
Formula: C16H18N3O6P
SMILES: |
P1(OCC2CC(OC2CO1)N1C=CC(=NC1=O)N)(Oc1ccccc1)=O |
InChI: |
InChI=1/C16H18N3O6P/c17-14-6-7-19(16(20)18-14)15-8-11-9-22-26(21,23-10-13(11)24-15)25-12-4-2-1-3-5-12/h1-7,11,13,15H,8-10H2,(H2,17,18,20)/t11-,13-,15-,26+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 379.309 g/mol | logS: -3.08445 | SlogP: 1.1878 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.056092 | Sterimol/B1: 2.31207 | Sterimol/B2: 3.38887 | Sterimol/B3: 3.91112 |
Sterimol/B4: 6.15894 | Sterimol/L: 18.558 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 588.236 | Positive charged surface: 365.464 | Negative charged surface: 222.772 | Volume: 316.5 |
Hydrophobic surface: 405.3 | Hydrophilic surface: 182.936 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |