 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(CC(C)C)C(=O)Nc1cc2c(cc1)cccc2)C1N(CCC1)C(=O)CN |
| InChI: | InChI=1/C23H30N4O3/c1-15(2)12-19(26-23(30)20-8-5-11-27(20)21(28)14-24)22(29)25-18-10-9-16-6-3-4-7-17(16)13-18/h3-4,6-7,9-10,13,15,19-20H,5,8,11-12,14,24H2,1-2H3,(H,25,29)(H,26,30)/t19-,20+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=147.545 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 410.518 g/mol | logS: -5.50716 | SlogP: 2.2589 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0995189 | Sterimol/B1: 3.17614 | Sterimol/B2: 3.69846 | Sterimol/B3: 6.52198 | |||
| Sterimol/B4: 8.19758 | Sterimol/L: 18.0867 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 715.928 | Positive charged surface: 483.466 | Negative charged surface: 221.544 | Volume: 405.25 | |||
| Hydrophobic surface: 543.582 | Hydrophilic surface: 172.346 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
