 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C2C(C(C[NH+]3CCN(CC3)c3ccccc3)C1=O)C(O)C1(C(C2)=CCCC1C)C |
| InChI: | InChI=1/C25H34N2O3/c1-17-7-6-8-18-15-21-22(23(28)25(17,18)2)20(24(29)30-21)16-26-11-13-27(14-12-26)19-9-4-3-5-10-19/h3-5,8-10,17,20-23,28H,6-7,11-16H2,1-2H3/p+1/t17-,20-,21-,22+,23-,25-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=121.554 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 411.566 g/mol | logS: -3.60275 | SlogP: 1.6765 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0825481 | Sterimol/B1: 2.18761 | Sterimol/B2: 4.17387 | Sterimol/B3: 4.49742 | |||
| Sterimol/B4: 7.65545 | Sterimol/L: 19.4588 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 673.004 | Positive charged surface: 485.675 | Negative charged surface: 187.329 | Volume: 420.125 | |||
| Hydrophobic surface: 534.012 | Hydrophilic surface: 138.992 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 6 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
