Type: Neutral
Formula: C10H16N3O6P
SMILES: |
P(O)(O)(=O)COCC1OC(N2C=CC(=NC2=O)N)CC1 |
InChI: |
InChI=1/C10H16N3O6P/c11-8-3-4-13(10(14)12-8)9-2-1-7(19-9)5-18-6-20(15,16)17/h3-4,7,9H,1-2,5-6H2,(H2,11,12,14)(H2,15,16,17)/t7-,9+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 305.227 g/mol | logS: -0.26219 | SlogP: -1.1204 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0965004 | Sterimol/B1: 2.52692 | Sterimol/B2: 4.2106 | Sterimol/B3: 4.27395 |
Sterimol/B4: 5.46723 | Sterimol/L: 14.1383 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 502.832 | Positive charged surface: 330.504 | Negative charged surface: 172.328 | Volume: 250.375 |
Hydrophobic surface: 242.68 | Hydrophilic surface: 260.152 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |