Type: Neutral
Formula: C10H14N2O6
SMILES: |
O1C(CO)C(CO)C(O)C1N1C=CC(=O)NC1=O |
InChI: |
InChI=1/C10H14N2O6/c13-3-5-6(4-14)18-9(8(5)16)12-2-1-7(15)11-10(12)17/h1-2,5-6,8-9,13-14,16H,3-4H2,(H,11,15,17)/t5-,6-,8+,9-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 258.23 g/mol | logS: 0.05202 | SlogP: -2.2615 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.125748 | Sterimol/B1: 2.37927 | Sterimol/B2: 3.11913 | Sterimol/B3: 4.45161 |
Sterimol/B4: 5.69057 | Sterimol/L: 13.2251 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 435.263 | Positive charged surface: 293.425 | Negative charged surface: 141.838 | Volume: 211.875 |
Hydrophobic surface: 194.926 | Hydrophilic surface: 240.337 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |