Type: Neutral
Formula: C17H21N3O4
SMILES: |
O1C(N2C=C(C)C(=O)NC2=O)C(NCc2ccccc2)CC1CO |
InChI: |
InChI=1/C17H21N3O4/c1-11-9-20(17(23)19-15(11)22)16-14(7-13(10-21)24-16)18-8-12-5-3-2-4-6-12/h2-6,9,13-14,16,18,21H,7-8,10H2,1H3,(H,19,22,23)/t13-,14+,16+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 331.372 g/mol | logS: -2.03029 | SlogP: 0.9741 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0954902 | Sterimol/B1: 2.17686 | Sterimol/B2: 2.52743 | Sterimol/B3: 4.33196 |
Sterimol/B4: 10.6162 | Sterimol/L: 15.0899 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 588.19 | Positive charged surface: 380.034 | Negative charged surface: 208.156 | Volume: 313.625 |
Hydrophobic surface: 411.612 | Hydrophilic surface: 176.578 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |