Type: Neutral
Formula: C10H14FN2O6P
SMILES: |
[PH](OCC1OC(N2C=C(C)C(=O)NC2=O)CC1F)(O)=O |
InChI: |
InChI=1/C10H14FN2O6P/c1-5-3-13(10(15)12-9(5)14)8-2-6(11)7(19-8)4-18-20(16)17/h3,6-8,20H,2,4H2,1H3,(H,16,17)(H,12,14,15)/t6-,7+,8+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 308.202 g/mol | logS: -1.30867 | SlogP: -0.3566 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.100565 | Sterimol/B1: 2.30251 | Sterimol/B2: 4.15312 | Sterimol/B3: 4.52682 |
Sterimol/B4: 5.56123 | Sterimol/L: 14.6955 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 499.73 | Positive charged surface: 266.393 | Negative charged surface: 233.337 | Volume: 241.875 |
Hydrophobic surface: 240.41 | Hydrophilic surface: 259.32 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |