 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(CO)C(NCc2ccccc2)CC1N1C=C(C)C(=O)NC1=O |
| InChI: | InChI=1/C17H21N3O4/c1-11-9-20(17(23)19-16(11)22)15-7-13(14(10-21)24-15)18-8-12-5-3-2-4-6-12/h2-6,9,13-15,18,21H,7-8,10H2,1H3,(H,19,22,23)/t13-,14+,15+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=42.3956 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 331.372 g/mol | logS: -2.03029 | SlogP: 0.9741 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0616826 | Sterimol/B1: 2.51203 | Sterimol/B2: 2.57984 | Sterimol/B3: 4.01873 | |||
| Sterimol/B4: 9.36915 | Sterimol/L: 16.7057 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 591.506 | Positive charged surface: 378.156 | Negative charged surface: 213.35 | Volume: 311.75 | |||
| Hydrophobic surface: 409.97 | Hydrophilic surface: 181.536 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
