 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCc1cnc(C)c(O)c1\C=N\C(CCCC[NH3+])C(=O)[O-])(=O)([O-])[O-] |
| InChI: | InChI=1/C14H22N3O7P/c1-9-13(18)11(10(6-16-9)8-24-25(21,22)23)7-17-12(14(19)20)4-2-3-5-15/h6-7,12,18H,2-5,8,15H2,1H3,(H,19,20)(H2,21,22,23)/p-2/b17-7+/t12-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=35.8068 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 373.302 g/mol | logS: -0.40927 | SlogP: -3.41328 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.247295 | Sterimol/B1: 2.19218 | Sterimol/B2: 2.72631 | Sterimol/B3: 7.85478 | |||
| Sterimol/B4: 10.2285 | Sterimol/L: 15.0307 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 633.543 | Positive charged surface: 380.62 | Negative charged surface: 252.923 | Volume: 320.625 | |||
| Hydrophobic surface: 294.462 | Hydrophilic surface: 339.081 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 5 | Basic groups: 1 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
