Type: Neutral
Formula: C13H14FN3O3
SMILES: |
Fc1cc2c([nH]cc2CC(NC(=O)CN)C(O)=O)cc1 |
InChI: |
InChI=1/C13H14FN3O3/c14-8-1-2-10-9(4-8)7(6-16-10)3-11(13(19)20)17-12(18)5-15/h1-2,4,6,11,16H,3,5,15H2,(H,17,18)(H,19,20)/t11-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 279.271 g/mol | logS: -1.86456 | SlogP: 0.37757 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.184175 | Sterimol/B1: 2.74065 | Sterimol/B2: 3.6359 | Sterimol/B3: 5.19189 |
Sterimol/B4: 6.51072 | Sterimol/L: 12.7661 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 490.69 | Positive charged surface: 294.116 | Negative charged surface: 192.421 | Volume: 245.125 |
Hydrophobic surface: 265.829 | Hydrophilic surface: 224.861 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |