 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1Nc2c(cc(cc2)C)C12N1C(C3C2C(=O)N(C3=O)c2ccccc2)CCC1 |
| InChI: | InChI=1/C23H21N3O3/c1-13-9-10-16-15(12-13)23(22(29)24-16)19-18(17-8-5-11-25(17)23)20(27)26(21(19)28)14-6-3-2-4-7-14/h2-4,6-7,9-10,12,17-19H,5,8,11H2,1H3,(H,24,29)/t17-,18-,19-,23-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=138.888 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 387.439 g/mol | logS: -4.72195 | SlogP: 2.73772 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.139706 | Sterimol/B1: 2.31079 | Sterimol/B2: 2.44561 | Sterimol/B3: 6.15503 | |||
| Sterimol/B4: 9.72692 | Sterimol/L: 14.8438 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 603.261 | Positive charged surface: 365.658 | Negative charged surface: 237.603 | Volume: 356.875 | |||
| Hydrophobic surface: 496.48 | Hydrophilic surface: 106.781 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.