Type: Neutral
Formula: C15H22O4
SMILES: |
O1C2C(C=C3C(C2)(CCCC3C)C)C(O)(CO)C1=O |
InChI: |
InChI=1/C15H22O4/c1-9-4-3-5-14(2)7-12-11(6-10(9)14)15(18,8-16)13(17)19-12/h6,9,11-12,16,18H,3-5,7-8H2,1-2H3/t9-,11-,12+,14+,15+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 266.337 g/mol | logS: -3.04176 | SlogP: 1.4078 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.22372 | Sterimol/B1: 2.28983 | Sterimol/B2: 3.16761 | Sterimol/B3: 4.24818 |
Sterimol/B4: 7.3594 | Sterimol/L: 11.8695 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 438.994 | Positive charged surface: 312.841 | Negative charged surface: 126.153 | Volume: 254.375 |
Hydrophobic surface: 272.086 | Hydrophilic surface: 166.908 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |