Type: Ionized
Formula: C4H12N3O7P2-
SMILES: |
P(O)(O)(=O)N\C(=N/CCOP(OC)(=O)[O-])\N |
InChI: |
InChI=1/C4H13N3O7P2/c1-13-16(11,12)14-3-2-6-4(5)7-15(8,9)10/h2-3H2,1H3,(H,11,12)(H5,5,6,7,8,9,10)/p-1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 276.102 g/mol | logS: 0.75077 | SlogP: -4.0256 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0603973 | Sterimol/B1: 3.13381 | Sterimol/B2: 3.20195 | Sterimol/B3: 3.80937 |
Sterimol/B4: 4.24096 | Sterimol/L: 14.9122 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 460.511 | Positive charged surface: 281.719 | Negative charged surface: 178.792 | Volume: 198.75 |
Hydrophobic surface: 160.371 | Hydrophilic surface: 300.14 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 2 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|