Type: Neutral
Formula: C4H13N3O7P2
SMILES: |
P(O)(O)(=O)N\C(=N/CCOP(OC)(O)=O)\N |
InChI: |
InChI=1/C4H13N3O7P2/c1-13-16(11,12)14-3-2-6-4(5)7-15(8,9)10/h2-3H2,1H3,(H,11,12)(H5,5,6,7,8,9,10) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 277.11 g/mol | logS: 0.82229 | SlogP: -3.3936 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0499257 | Sterimol/B1: 2.41205 | Sterimol/B2: 3.12518 | Sterimol/B3: 3.58482 |
Sterimol/B4: 4.98634 | Sterimol/L: 15.1492 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 473.315 | Positive charged surface: 303.735 | Negative charged surface: 169.58 | Volume: 201.375 |
Hydrophobic surface: 161.077 | Hydrophilic surface: 312.238 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules
|