 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1CCN(CC1)CCN(C(C(=O)NC1CCCC1)c1ccncc1)C(=O)c1[nH]c(cc1)-c1c cccc1 |
| InChI: | InChI=1/C29H35N5O3/c35-28(31-24-8-4-5-9-24)27(23-12-14-30-15-13-23)34(17-16-33-18-20-37-21-19-33)29(36)26-11-10-25(32-26)22-6-2-1-3-7-22/h1-3,6-7,10-15,24,27,32H,4-5,8-9,16-21H2,(H,31,35)/t27-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=211.493 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 501.631 g/mol | logS: -4.24396 | SlogP: 3.7467 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.129755 | Sterimol/B1: 5.05933 | Sterimol/B2: 5.17355 | Sterimol/B3: 5.35539 | |||
| Sterimol/B4: 6.32496 | Sterimol/L: 19 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 754.734 | Positive charged surface: 524.501 | Negative charged surface: 230.233 | Volume: 491.5 | |||
| Hydrophobic surface: 670.999 | Hydrophilic surface: 83.735 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules
