Type: Neutral
Formula: C19H29BrO2
SMILES: |
BrC1C2(C(C3C(C1=O)C1(C(CC(O)CC1)CC3)C)CCC2)C |
InChI: |
InChI=1/C19H29BrO2/c1-18-9-7-12(21)10-11(18)5-6-13-14-4-3-8-19(14,2)17(20)16(22)15(13)18/h11-15,17,21H,3-10H2,1-2H3/t11-,12+,13-,14+,15+,17-,18-,19-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 369.343 g/mol | logS: -5.13132 | SlogP: 4.7524 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.166279 | Sterimol/B1: 2.00688 | Sterimol/B2: 4.65147 | Sterimol/B3: 5.66812 |
Sterimol/B4: 5.80104 | Sterimol/L: 13.4853 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 510.53 | Positive charged surface: 329.009 | Negative charged surface: 181.521 | Volume: 328.75 |
Hydrophobic surface: 352.751 | Hydrophilic surface: 157.779 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 8 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |