Type: Neutral
Formula: C19H20N4O3
SMILES: |
o1cccc1C1n2nc(nc2NC(=C1)c1ccc(OC)cc1)CCCO |
InChI: |
InChI=1/C19H20N4O3/c1-25-14-8-6-13(7-9-14)15-12-16(17-4-3-11-26-17)23-19(20-15)21-18(22-23)5-2-10-24/h3-4,6-9,11-12,16,24H,2,5,10H2,1H3,(H,20,21,22)/t16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 352.394 g/mol | logS: -4.19963 | SlogP: 2.95607 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0351687 | Sterimol/B1: 3.47061 | Sterimol/B2: 3.83208 | Sterimol/B3: 4.00795 |
Sterimol/B4: 8.35871 | Sterimol/L: 19.8242 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 645.773 | Positive charged surface: 428.827 | Negative charged surface: 216.946 | Volume: 333 |
Hydrophobic surface: 505.897 | Hydrophilic surface: 139.876 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |