Type: Neutral
Formula: C15H22N4O5
SMILES: |
O=C1NC(=O)NC=C1C(=O)NC(C(=O)NCC1CCCCC1)CO |
InChI: |
InChI=1/C15H22N4O5/c20-8-11(14(23)16-6-9-4-2-1-3-5-9)18-12(21)10-7-17-15(24)19-13(10)22/h7,9,11,20H,1-6,8H2,(H,16,23)(H,18,21)(H2,17,19,22,24)/t11-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 338.364 g/mol | logS: -2.73961 | SlogP: -1.1167 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0408587 | Sterimol/B1: 2.45311 | Sterimol/B2: 3.41479 | Sterimol/B3: 4.48123 |
Sterimol/B4: 4.65545 | Sterimol/L: 19.0435 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 582.567 | Positive charged surface: 407.996 | Negative charged surface: 174.571 | Volume: 304.875 |
Hydrophobic surface: 322.111 | Hydrophilic surface: 260.456 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |