Type: Neutral
Formula: C13H15N5O2S2
SMILES: |
S1C(=NNC1=S)NC(=O)NC(Cc1ccccc1)C(=O)NC |
InChI: |
InChI=1/C13H15N5O2S2/c1-14-10(19)9(7-8-5-3-2-4-6-8)15-11(20)16-12-17-18-13(21)22-12/h2-6,9H,7H2,1H3,(H,14,19)(H,18,21)(H2,15,16,17,20)/t9-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 337.428 g/mol | logS: -4.08316 | SlogP: 0.53517 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.125506 | Sterimol/B1: 1.969 | Sterimol/B2: 3.60659 | Sterimol/B3: 4.43836 |
Sterimol/B4: 11.0119 | Sterimol/L: 14.2936 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 576.394 | Positive charged surface: 313.514 | Negative charged surface: 262.879 | Volume: 293.625 |
Hydrophobic surface: 294.643 | Hydrophilic surface: 281.751 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |