Type: Neutral
Formula: C11H14N4O5S
SMILES: |
S(C)C1=NC(=O)C2=NC=C(NC2=N1)C(O)C(O)C(O)CO |
InChI: |
InChI=1/C11H14N4O5S/c1-21-11-14-9-6(10(20)15-11)12-2-4(13-9)7(18)8(19)5(17)3-16/h2,5,7-8,16-19H,3H2,1H3,(H,13,14,15,20)/t5-,7-,8-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 314.322 g/mol | logS: -2.02687 | SlogP: -2.3953 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.045975 | Sterimol/B1: 2.88544 | Sterimol/B2: 3.05357 | Sterimol/B3: 4.04232 |
Sterimol/B4: 6.0485 | Sterimol/L: 16.5274 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 515.547 | Positive charged surface: 313.382 | Negative charged surface: 202.165 | Volume: 258.625 |
Hydrophobic surface: 192.728 | Hydrophilic surface: 322.819 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |