Type: Neutral
Formula: C12H14ClN7O2
SMILES: |
Clc1nc(nc(n1)NC(CC)CO)NC(=O)c1nccnc1 |
InChI: |
InChI=1/C12H14ClN7O2/c1-2-7(6-21)16-11-18-10(13)19-12(20-11)17-9(22)8-5-14-3-4-15-8/h3-5,7,21H,2,6H2,1H3,(H2,16,17,18,19,20,22)/t7-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 323.744 g/mol | logS: -2.71924 | SlogP: 0.7501 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0357189 | Sterimol/B1: 2.41633 | Sterimol/B2: 4.26192 | Sterimol/B3: 4.46188 |
Sterimol/B4: 5.9538 | Sterimol/L: 16.8163 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 548.157 | Positive charged surface: 382.903 | Negative charged surface: 165.254 | Volume: 277.125 |
Hydrophobic surface: 339.186 | Hydrophilic surface: 208.971 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |