Type: Neutral
Formula: C13H22N2O4
SMILES: |
O(C(CC)C)C1C=C(CC(N)C1NC(=O)C)C(O)=O |
InChI: |
InChI=1/C13H22N2O4/c1-4-7(2)19-11-6-9(13(17)18)5-10(14)12(11)15-8(3)16/h6-7,10-12H,4-5,14H2,1-3H3,(H,15,16)(H,17,18)/t7-,10+,11-,12-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 270.329 g/mol | logS: -1.00267 | SlogP: 0.4168 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.117618 | Sterimol/B1: 2.22897 | Sterimol/B2: 2.65267 | Sterimol/B3: 4.06173 |
Sterimol/B4: 9.38123 | Sterimol/L: 11.7599 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 495.002 | Positive charged surface: 344.967 | Negative charged surface: 150.035 | Volume: 263.625 |
Hydrophobic surface: 274.397 | Hydrophilic surface: 220.605 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |