Type: Neutral
Formula: C13H21N3O5
SMILES: |
O1C(C(=O)N(CC)CC)C(NC(=O)C)C(N)C=C1C(O)=O |
InChI: |
InChI=1/C13H21N3O5/c1-4-16(5-2)12(18)11-10(15-7(3)17)8(14)6-9(21-11)13(19)20/h6,8,10-11H,4-5,14H2,1-3H3,(H,15,17)(H,19,20)/t8-,10+,11+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 299.327 g/mol | logS: -0.91974 | SlogP: -0.9459 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.13422 | Sterimol/B1: 2.56108 | Sterimol/B2: 2.85651 | Sterimol/B3: 4.17724 |
Sterimol/B4: 9.29131 | Sterimol/L: 13.1559 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 499.031 | Positive charged surface: 338.118 | Negative charged surface: 160.913 | Volume: 277.875 |
Hydrophobic surface: 259.267 | Hydrophilic surface: 239.764 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |