 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1N=C(Nc2[nH]cc(c12)CCc1ccc(cc1)C(=O)NC(C(C)C)C(O)=O)N |
| InChI: | InChI=1/C20H23N5O4/c1-10(2)15(19(28)29)23-17(26)12-6-3-11(4-7-12)5-8-13-9-22-16-14(13)18(27)25-20(21)24-16/h3-4,6-7,9-10,15H,5,8H2,1-2H3,(H,23,26)(H,28,29)(H4,21,22,24,25,27)/t15-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=62.7776 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 397.435 g/mol | logS: -3.94371 | SlogP: 1.51924 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0261641 | Sterimol/B1: 2.39063 | Sterimol/B2: 3.07256 | Sterimol/B3: 5.2197 | |||
| Sterimol/B4: 5.73195 | Sterimol/L: 21.1743 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 675.02 | Positive charged surface: 420.782 | Negative charged surface: 254.238 | Volume: 368.25 | |||
| Hydrophobic surface: 323.338 | Hydrophilic surface: 351.682 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 6 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
