Type: Neutral
Formula: C13H23NO9
SMILES: |
O1C(C(O)C(O)CO)C(NC(=O)C)C(O)CC1(OC)C(OC)=O |
InChI: |
InChI=1/C13H23NO9/c1-6(16)14-9-7(17)4-13(22-3,12(20)21-2)23-11(9)10(19)8(18)5-15/h7-11,15,17-19H,4-5H2,1-3H3,(H,14,16)/t7-,8+,9-,10+,11-,13+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 337.325 g/mol | logS: -0.06033 | SlogP: -3.1293 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.210774 | Sterimol/B1: 2.8156 | Sterimol/B2: 3.78568 | Sterimol/B3: 5.34326 |
Sterimol/B4: 9.10483 | Sterimol/L: 13.79 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 549.314 | Positive charged surface: 423.827 | Negative charged surface: 125.487 | Volume: 294.875 |
Hydrophobic surface: 345.561 | Hydrophilic surface: 203.753 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 6 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |