 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(CO)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N |
| InChI: | InChI=1/C12H25N3O7/c13-3-1-4(14)11(10(20)7(3)17)22-12-6(15)9(19)8(18)5(2-16)21-12/h3-12,16-20H,1-2,13-15H2/t3-,4+,5-,6+,7-,8+,9-,10-,11+,12+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=133.582 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 323.346 g/mol | logS: 1.68262 | SlogP: -5.082 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.180986 | Sterimol/B1: 2.80314 | Sterimol/B2: 4.41166 | Sterimol/B3: 5.36784 | |||
| Sterimol/B4: 5.55264 | Sterimol/L: 13.1958 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 517.305 | Positive charged surface: 424.754 | Negative charged surface: 92.5514 | Volume: 283.625 | |||
| Hydrophobic surface: 188.968 | Hydrophilic surface: 328.337 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 8 | Hydrogen bond acceptors: 10 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 10 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules
