Type: Neutral
Formula: C17H25N3OS
SMILES: |
s1cc(nc1C(N)CC)C(=O)NC1C2CC3CC1CC(C2)C3 |
InChI: |
InChI=1/C17H25N3OS/c1-2-13(18)17-19-14(8-22-17)16(21)20-15-11-4-9-3-10(6-11)7-12(15)5-9/h8-13,15H,2-7,18H2,1H3,(H,20,21)/t9-,10+,11-,12+,13-,15-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 319.473 g/mol | logS: -3.28032 | SlogP: 3.2029 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0818666 | Sterimol/B1: 2.25047 | Sterimol/B2: 3.44867 | Sterimol/B3: 4.32953 |
Sterimol/B4: 7.40093 | Sterimol/L: 15.532 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 559.454 | Positive charged surface: 392.922 | Negative charged surface: 166.532 | Volume: 308.625 |
Hydrophobic surface: 453.073 | Hydrophilic surface: 106.381 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |