 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(CC)c1cc(ccc1)C(N1CC(CCC1)C(O)=O)c1ccc(cc1)-c1ccccc1 |
| InChI: | InChI=1/C27H29NO3/c1-2-31-25-12-6-10-23(18-25)26(28-17-7-11-24(19-28)27(29)30)22-15-13-21(14-16-22)20-8-4-3-5-9-20/h3-6,8-10,12-16,18,24,26H,2,7,11,17,19H2,1H3,(H,29,30)/t24-,26-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=103.815 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 415.533 g/mol | logS: -6.1329 | SlogP: 5.7338 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.115714 | Sterimol/B1: 2.20447 | Sterimol/B2: 2.98173 | Sterimol/B3: 5.54947 | |||
| Sterimol/B4: 11.9942 | Sterimol/L: 17.7182 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 723.794 | Positive charged surface: 447.117 | Negative charged surface: 265.81 | Volume: 422.5 | |||
| Hydrophobic surface: 603.282 | Hydrophilic surface: 120.512 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.