 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OCC(NC(=O)\C=C\c1c2c([nH]c1)cccc2)C(=O)NC1CCCC1 |
| InChI: | InChI=1/C19H23N3O3/c23-12-17(19(25)21-14-5-1-2-6-14)22-18(24)10-9-13-11-20-16-8-4-3-7-15(13)16/h3-4,7-11,14,17,20,23H,1-2,5-6,12H2,(H,21,25)(H,22,24)/b10-9+/t17-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=57.6012 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 341.411 g/mol | logS: -3.25268 | SlogP: 1.717 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0495359 | Sterimol/B1: 2.46228 | Sterimol/B2: 3.17764 | Sterimol/B3: 4.97187 | |||
| Sterimol/B4: 5.81871 | Sterimol/L: 20.6015 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 639.437 | Positive charged surface: 400.409 | Negative charged surface: 233.184 | Volume: 336.375 | |||
| Hydrophobic surface: 475.915 | Hydrophilic surface: 163.522 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.