Type: Neutral
Formula: C15H19ClN2S
SMILES: |
Clc1cc(NC(=S)NC2C3CC(C2)CC3)c(cc1)C |
InChI: |
InChI=1/C15H19ClN2S/c1-9-2-5-12(16)8-13(9)17-15(19)18-14-7-10-3-4-11(14)6-10/h2,5,8,10-11,14H,3-4,6-7H2,1H3,(H2,17,18,19)/t10-,11+,14+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 294.85 g/mol | logS: -5.11046 | SlogP: 4.12342 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0582272 | Sterimol/B1: 1.969 | Sterimol/B2: 3.42122 | Sterimol/B3: 3.60056 |
Sterimol/B4: 8.03245 | Sterimol/L: 15.0171 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 520.75 | Positive charged surface: 301.31 | Negative charged surface: 219.44 | Volume: 281 |
Hydrophobic surface: 451.282 | Hydrophilic surface: 69.468 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |