 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | s1cc(nc1C1NCCC1)C(=O)NCc1ccc(S(=O)(=O)N)cc1 |
| InChI: | InChI=1/C15H18N4O3S2/c16-24(21,22)11-5-3-10(4-6-11)8-18-14(20)13-9-23-15(19-13)12-2-1-7-17-12/h3-6,9,12,17H,1-2,7-8H2,(H,18,20)(H2,16,21,22)/t12-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=22.6038 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 366.466 g/mol | logS: -2.67277 | SlogP: 1.5069 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.052107 | Sterimol/B1: 2.48904 | Sterimol/B2: 4.82306 | Sterimol/B3: 4.84013 | |||
| Sterimol/B4: 5.56709 | Sterimol/L: 17.9297 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 610.901 | Positive charged surface: 359.205 | Negative charged surface: 251.695 | Volume: 315 | |||
| Hydrophobic surface: 394.897 | Hydrophilic surface: 216.004 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
