Type: Neutral
Formula: C15H18N4O5
SMILES: |
O1C(CO)C(O)C(O)C1N1C=C(c2ccc(N)cc2)C(=NC1=O)N |
InChI: |
InChI=1/C15H18N4O5/c16-8-3-1-7(2-4-8)9-5-19(15(23)18-13(9)17)14-12(22)11(21)10(6-20)24-14/h1-5,10-12,14,20-22H,6,16H2,(H2,17,18,23)/t10-,11+,12-,14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 334.332 g/mol | logS: -1.57078 | SlogP: -1.1585 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.070595 | Sterimol/B1: 2.25512 | Sterimol/B2: 4.45822 | Sterimol/B3: 4.94032 |
Sterimol/B4: 5.9989 | Sterimol/L: 14.5975 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 554.49 | Positive charged surface: 382.767 | Negative charged surface: 171.723 | Volume: 293 |
Hydrophobic surface: 244.492 | Hydrophilic surface: 309.998 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |