 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | o1cc(nc1C(N)Cc1c2c([nH]c1)cccc2)C(=O)NCCCc1ccccc1 |
| InChI: | InChI=1/C23H24N4O2/c24-19(13-17-14-26-20-11-5-4-10-18(17)20)23-27-21(15-29-23)22(28)25-12-6-9-16-7-2-1-3-8-16/h1-5,7-8,10-11,14-15,19,26H,6,9,12-13,24H2,(H,25,28)/t19-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=75.3359 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 388.471 g/mol | logS: -4.14561 | SlogP: 3.85644 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0298536 | Sterimol/B1: 2.42595 | Sterimol/B2: 3.55591 | Sterimol/B3: 3.942 | |||
| Sterimol/B4: 8.94272 | Sterimol/L: 21.2049 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 724.872 | Positive charged surface: 440.496 | Negative charged surface: 279.842 | Volume: 385.25 | |||
| Hydrophobic surface: 563.466 | Hydrophilic surface: 161.406 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.