Type: Neutral
Formula: C18H25NO3
SMILES: |
O(C)c1cc(ccc1OC)CCNC(=O)C1C2CC(C1)CC2 |
InChI: |
InChI=1/C18H25NO3/c1-21-16-6-4-12(11-17(16)22-2)7-8-19-18(20)15-10-13-3-5-14(15)9-13/h4,6,11,13-15H,3,5,7-10H2,1-2H3,(H,19,20)/t13-,14+,15-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 303.402 g/mol | logS: -3.96094 | SlogP: 2.79867 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0569139 | Sterimol/B1: 2.65619 | Sterimol/B2: 2.87621 | Sterimol/B3: 4.46938 |
Sterimol/B4: 7.04074 | Sterimol/L: 17.6535 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 583.565 | Positive charged surface: 460.563 | Negative charged surface: 123.002 | Volume: 309.25 |
Hydrophobic surface: 533.864 | Hydrophilic surface: 49.701 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |