 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(C2OC(OC2C1n1c2ncnc(N)c2nc1)(C)C)COC(=O)c1ccccc1 |
| InChI: | InChI=1/C20H21N5O5/c1-20(2)29-14-12(8-27-19(26)11-6-4-3-5-7-11)28-18(15(14)30-20)25-10-24-13-16(21)22-9-23-17(13)25/h3-7,9-10,12,14-15,18H,8H2,1-2H3,(H2,21,22,23)/t12-,14-,15-,18+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=112.862 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 411.418 g/mol | logS: -4.89087 | SlogP: 1.7785 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0946357 | Sterimol/B1: 2.3923 | Sterimol/B2: 4.02097 | Sterimol/B3: 4.54219 | |||
| Sterimol/B4: 9.92712 | Sterimol/L: 17.3039 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 665.85 | Positive charged surface: 446.864 | Negative charged surface: 218.986 | Volume: 367.125 | |||
| Hydrophobic surface: 409.083 | Hydrophilic surface: 256.767 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.