Type: Neutral
Formula: C6H15N2O7P
SMILES: |
P(OC1C(N)C(O)C(N)C(O)C1O)(O)(O)=O |
InChI: |
InChI=1/C6H15N2O7P/c7-1-3(9)2(8)6(5(11)4(1)10)15-16(12,13)14/h1-6,9-11H,7-8H2,(H2,12,13,14)/t1-,2-,3-,4+,5+,6-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 258.167 g/mol | logS: 1.90048 | SlogP: -4.855 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.182721 | Sterimol/B1: 3.20793 | Sterimol/B2: 3.64717 | Sterimol/B3: 4.18307 |
Sterimol/B4: 4.5872 | Sterimol/L: 12.3124 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 418.022 | Positive charged surface: 286.676 | Negative charged surface: 131.346 | Volume: 195.5 |
Hydrophobic surface: 67.6319 | Hydrophilic surface: 350.3901 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 8 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 6 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |