Type: Neutral
Formula: C14H19NO6
SMILES: |
O1C(CO)C(O)C(O)C(NC(=O)c2ccccc2C)C1O |
InChI: |
InChI=1/C14H19NO6/c1-7-4-2-3-5-8(7)13(19)15-10-12(18)11(17)9(6-16)21-14(10)20/h2-5,9-12,14,16-18,20H,6H2,1H3,(H,15,19)/t9-,10-,11+,12-,14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 297.307 g/mol | logS: -1.36698 | SlogP: -1.47528 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.07227 | Sterimol/B1: 2.16065 | Sterimol/B2: 2.803 | Sterimol/B3: 4.1172 |
Sterimol/B4: 6.42937 | Sterimol/L: 15.7515 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 514.819 | Positive charged surface: 349.934 | Negative charged surface: 164.885 | Volume: 268.125 |
Hydrophobic surface: 316.203 | Hydrophilic surface: 198.616 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |