 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1CCCC1CNC=1NC(=O)CC(N=1)C(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI: | InChI=1/C22H24N4O4/c27-20-13-19(25-22(26-20)23-14-18-7-4-12-29-18)21(28)24-15-8-10-17(11-9-15)30-16-5-2-1-3-6-16/h1-3,5-6,8-11,18-19H,4,7,12-14H2,(H,24,28)(H2,23,25,26,27)/t18-,19+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=78.6837 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 408.458 g/mol | logS: -4.59133 | SlogP: 2.4305 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0382259 | Sterimol/B1: 2.19156 | Sterimol/B2: 2.3901 | Sterimol/B3: 5.36584 | |||
| Sterimol/B4: 8.30617 | Sterimol/L: 21.9384 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 715.958 | Positive charged surface: 475.14 | Negative charged surface: 240.819 | Volume: 383.125 | |||
| Hydrophobic surface: 562.154 | Hydrophilic surface: 153.804 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.